C21H39NO5 — CID 66882543
(2-oxo-1,3-dioxolan-4-yl)methyl N,N-dioctylcarbamate (PubChem CID 66882543) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl N,N-dioctylcarbamate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl N,N-dioctylcarbamate |
|---|---|
| PubChem CID | 66882543 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl N,N-dioctylcarbamate |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C21H39NO5/c1-3-5-7-9-11-13-15-22(16-14-12-10-8-6-4-2)20(23)25-17-19-18-26-21(24)27-19/h19H,3-18H2,1-2H3 |
| InChIKey | AZPUOCZFXWAHMK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|