C21H40O3 — CID 139653097
4-octadecyl-1,3-dioxolan-2-one (PubChem CID 139653097) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 4-octadecyl-1,3-dioxolan-2-one.
| Compound Name | 4-octadecyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 139653097 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 4-octadecyl-1,3-dioxolan-2-one |
| SMILES | CCCCCCCCCCCCCCCCCCC1COC(=O)O1 |
| InChI | InChI=1S/C21H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-23-21(22)24-20/h20H,2-19H2,1H3 |
| InChIKey | LFGAISPTGICNMM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|