C18H33IO3 — CID 46830433
(4R,6R)-4-(iodomethyl)-6-tridecyl-1,3-dioxan-2-one (PubChem CID 46830433) has the molecular formula C18H33IO3 and a molecular weight of 424.36 g/mol. Its IUPAC name is (4R,6R)-4-(iodomethyl)-6-tridecyl-1,3-dioxan-2-one.
| Compound Name | (4R,6R)-4-(iodomethyl)-6-tridecyl-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 46830433 |
| Molecular Formula | C18H33IO3 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (4R,6R)-4-(iodomethyl)-6-tridecyl-1,3-dioxan-2-one |
| SMILES | CCCCCCCCCCCCC[C@@H]1C[C@H](CI)OC(=O)O1 |
| InChI | InChI=1S/C18H33IO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-14-17(15-19)22-18(20)21-16/h16-17H,2-15H2,1H3/t16-,17-/m1/s1 |
| InChIKey | SVVGZRZNLKDXEL-IAGOWNOFSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|