C12H21IO2 — CID 10990947
(3R,5S)-3-heptyl-5-(iodomethyl)oxolan-2-one (PubChem CID 10990947) has the molecular formula C12H21IO2 and a molecular weight of 324.20 g/mol. Its IUPAC name is (3R,5S)-3-heptyl-5-(iodomethyl)oxolan-2-one.
| Compound Name | (3R,5S)-3-heptyl-5-(iodomethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10990947 |
| Molecular Formula | C12H21IO2 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (3R,5S)-3-heptyl-5-(iodomethyl)oxolan-2-one |
| SMILES | CCCCCCC[C@@H]1C[C@@H](CI)OC1=O |
| InChI | InChI=1S/C12H21IO2/c1-2-3-4-5-6-7-10-8-11(9-13)15-12(10)14/h10-11H,2-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | RJWSSUKUTNYBSM-MNOVXSKESA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|