C16H30O3 — CID 162927277
(3S,5S)-5-decyl-3-(2-hydroxyethyl)oxolan-2-one (PubChem CID 162927277) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (3S,5S)-5-decyl-3-(2-hydroxyethyl)oxolan-2-one.
| Compound Name | (3S,5S)-5-decyl-3-(2-hydroxyethyl)oxolan-2-one |
|---|---|
| PubChem CID | 162927277 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (3S,5S)-5-decyl-3-(2-hydroxyethyl)oxolan-2-one |
| SMILES | CCCCCCCCCC[C@H]1C[C@H](CCO)C(=O)O1 |
| InChI | InChI=1S/C16H30O3/c1-2-3-4-5-6-7-8-9-10-15-13-14(11-12-17)16(18)19-15/h14-15,17H,2-13H2,1H3/t14-,15-/m0/s1 |
| InChIKey | WTYOCFGPMRJBIX-GJZGRUSLSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|