C11H20O3 — CID 129382353
(4S)-4-octyl-1,3-dioxolan-2-one (PubChem CID 129382353) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4S)-4-octyl-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-octyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 129382353 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4S)-4-octyl-1,3-dioxolan-2-one |
| SMILES | CCCCCCCC[C@H]1COC(=O)O1 |
| InChI | InChI=1S/C11H20O3/c1-2-3-4-5-6-7-8-10-9-13-11(12)14-10/h10H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | XODUKNUDFZMDRF-JTQLQIEISA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|