C9H16O3 — CID 15403459
(4R)-4-hexyl-1,3-dioxolan-2-one (PubChem CID 15403459) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (4R)-4-hexyl-1,3-dioxolan-2-one.
| Compound Name | (4R)-4-hexyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 15403459 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (4R)-4-hexyl-1,3-dioxolan-2-one |
| SMILES | CCCCCC[C@@H]1COC(=O)O1 |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-6-8-7-11-9(10)12-8/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | KVOZCZVWECMVDU-MRVPVSSYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|