C26H42O6 — CID 154328345
bis(oxiran-2-ylmethyl) 7-ethenyloctadec-9-enedioate (PubChem CID 154328345) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) 7-ethenyloctadec-9-enedioate.
| Compound Name | bis(oxiran-2-ylmethyl) 7-ethenyloctadec-9-enedioate |
|---|---|
| PubChem CID | 154328345 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | bis(oxiran-2-ylmethyl) 7-ethenyloctadec-9-enedioate |
| SMILES | C=CC(CC=CCCCCCCCC(=O)OCC1CO1)CCCCCC(=O)OCC1CO1 |
| InChI | InChI=1S/C26H42O6/c1-2-22(15-11-9-13-17-26(28)32-21-24-19-30-24)14-10-7-5-3-4-6-8-12-16-25(27)31-20-23-18-29-23/h2,7,10,22-24H,1,3-6,8-9,11-21H2 |
| InChIKey | KITSPDQASCGWJQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|