C28H46O5 — CID 54288567
oxiran-2-ylmethyl (8Z,12E)-8,13-dimethyl-21-(oxiran-2-yl)-20-oxohenicosa-8,12-dienoate (PubChem CID 54288567) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is oxiran-2-ylmethyl (8Z,12E)-8,13-dimethyl-21-(oxiran-2-yl)-20-oxohenicosa-8,12-dienoate.
| Compound Name | oxiran-2-ylmethyl (8Z,12E)-8,13-dimethyl-21-(oxiran-2-yl)-20-oxohenicosa-8,12-dienoate |
|---|---|
| PubChem CID | 54288567 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | oxiran-2-ylmethyl (8Z,12E)-8,13-dimethyl-21-(oxiran-2-yl)-20-oxohenicosa-8,12-dienoate |
| SMILES | C/C(=C/CC/C=C(\C)CCCCCCC(=O)CC1CO1)CCCCCCC(=O)OCC1CO1 |
| InChI | InChI=1S/C28H46O5/c1-23(13-7-3-5-9-17-25(29)19-26-20-31-26)15-11-12-16-24(2)14-8-4-6-10-18-28(30)33-22-27-21-32-27/h15-16,26-27H,3-14,17-22H2,1-2H3/b23-15+,24-16- |
| InChIKey | RVWVNIHNUXEHEE-LGBOEXNSSA-N |
| XLogP | 6.64 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|