C10H16O7 — CID 59844671
2-ethoxyethyl 2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]acetate (PubChem CID 59844671) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]acetate.
| Compound Name | 2-ethoxyethyl 2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]acetate |
|---|---|
| PubChem CID | 59844671 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-ethoxyethyl 2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]acetate |
| SMILES | CCOCCOC(=O)COCC1COC(=O)O1 |
| InChI | InChI=1S/C10H16O7/c1-2-13-3-4-15-9(11)7-14-5-8-6-16-10(12)17-8/h8H,2-7H2,1H3 |
| InChIKey | FLNBNDLRCFLONS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|