C8H15NO5 — CID 163561102
(4S)-4-[3-[hydroxy(methyl)amino]propoxymethyl]-1,3-dioxolan-2-one (PubChem CID 163561102) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (4S)-4-[3-[hydroxy(methyl)amino]propoxymethyl]-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-[3-[hydroxy(methyl)amino]propoxymethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 163561102 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (4S)-4-[3-[hydroxy(methyl)amino]propoxymethyl]-1,3-dioxolan-2-one |
| SMILES | CN(O)CCCOC[C@H]1COC(=O)O1 |
| InChI | InChI=1S/C8H15NO5/c1-9(11)3-2-4-12-5-7-6-13-8(10)14-7/h7,11H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | FRGZFJJUYBCANG-ZETCQYMHSA-N |
| XLogP | 0.25 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|