C8H14Cl2O4Si — CID 102323538
4-[3-[dichloro(methyl)silyl]propoxymethyl]-1,3-dioxolan-2-one (PubChem CID 102323538) has the molecular formula C8H14Cl2O4Si and a molecular weight of 273.19 g/mol. Its IUPAC name is 4-[3-[dichloro(methyl)silyl]propoxymethyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[3-[dichloro(methyl)silyl]propoxymethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 102323538 |
| Molecular Formula | C8H14Cl2O4Si |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 4-[3-[dichloro(methyl)silyl]propoxymethyl]-1,3-dioxolan-2-one |
| SMILES | C[Si](Cl)(Cl)CCCOCC1COC(=O)O1 |
| InChI | InChI=1S/C8H14Cl2O4Si/c1-15(9,10)4-2-3-12-5-7-6-13-8(11)14-7/h7H,2-6H2,1H3 |
| InChIKey | LDHHPBKDPRTQSP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|