C10H20O7Si — CID 155795839
4-[3-[hydroxymethoxy-(hydroxymethyl)-methylsilyl]propoxymethyl]-1,3-dioxolan-2-one (PubChem CID 155795839) has the molecular formula C10H20O7Si and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[3-[hydroxymethoxy-(hydroxymethyl)-methylsilyl]propoxymethyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[3-[hydroxymethoxy-(hydroxymethyl)-methylsilyl]propoxymethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 155795839 |
| Molecular Formula | C10H20O7Si |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-[3-[hydroxymethoxy-(hydroxymethyl)-methylsilyl]propoxymethyl]-1,3-dioxolan-2-one |
| SMILES | C[Si](CO)(CCCOCC1COC(=O)O1)OCO |
| InChI | InChI=1S/C10H20O7Si/c1-18(8-12,16-7-11)4-2-3-14-5-9-6-15-10(13)17-9/h9,11-12H,2-8H2,1H3 |
| InChIKey | YXKMXSPQZQSIKS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|