C13H22O8 — CID 163276160
[2-methoxy-3-[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]butoxy]propyl] formate (PubChem CID 163276160) has the molecular formula C13H22O8 and a molecular weight of 306.31 g/mol. Its IUPAC name is [2-methoxy-3-[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]butoxy]propyl] formate.
| Compound Name | [2-methoxy-3-[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]butoxy]propyl] formate |
|---|---|
| PubChem CID | 163276160 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | [2-methoxy-3-[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]butoxy]propyl] formate |
| SMILES | COC(COC=O)COCCCCOCC1COC(=O)O1 |
| InChI | InChI=1S/C13H22O8/c1-16-11(7-19-10-14)6-17-4-2-3-5-18-8-12-9-20-13(15)21-12/h10-12H,2-9H2,1H3 |
| InChIKey | NSZQARJYDBXBMW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|