C28H52O8 — CID 158637776
carbon dioxide;4-(2-propylheptoxymethyl)-1,3-dioxolan-2-one;2-(2-propylheptoxymethyl)oxirane (PubChem CID 158637776) has the molecular formula C28H52O8 and a molecular weight of 516.72 g/mol. Its IUPAC name is carbon dioxide;4-(2-propylheptoxymethyl)-1,3-dioxolan-2-one;2-(2-propylheptoxymethyl)oxirane.
| Compound Name | carbon dioxide;4-(2-propylheptoxymethyl)-1,3-dioxolan-2-one;2-(2-propylheptoxymethyl)oxirane |
|---|---|
| PubChem CID | 158637776 |
| Molecular Formula | C28H52O8 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | carbon dioxide;4-(2-propylheptoxymethyl)-1,3-dioxolan-2-one;2-(2-propylheptoxymethyl)oxirane |
| SMILES | CCCCCC(CCC)COCC1CO1.CCCCCC(CCC)COCC1COC(=O)O1.O=C=O |
| InChI | InChI=1S/C14H26O4.C13H26O2.CO2/c1-3-5-6-8-12(7-4-2)9-16-10-13-11-17-14(15)18-13;1-3-5-6-8-12(7-4-2)9-14-10-13-11-15-13;2-1-3/h12-13H,3-11H2,1-2H3;12-13H,3-11H2,1-2H3; |
| InChIKey | HZZGQEMQOAJLCN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 100.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|