C7H10O5 — CID 13170397
4-(oxiran-2-ylmethoxymethyl)-1,3-dioxolan-2-one (PubChem CID 13170397) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 4-(oxiran-2-ylmethoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(oxiran-2-ylmethoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 13170397 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 4-(oxiran-2-ylmethoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COCC2CO2)O1 |
| InChI | InChI=1S/C7H10O5/c8-7-11-4-6(12-7)2-9-1-5-3-10-5/h5-6H,1-4H2 |
| InChIKey | CTBUGFRHKICZEB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|