C7H8F4O4 — CID 97104260
(4R)-4-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-dioxolan-2-one (PubChem CID 97104260) has the molecular formula C7H8F4O4 and a molecular weight of 232.13 g/mol. Its IUPAC name is (4R)-4-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | (4R)-4-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 97104260 |
| Molecular Formula | C7H8F4O4 |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (4R)-4-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OC[C@@H](COCC(F)(F)C(F)F)O1 |
| InChI | InChI=1S/C7H8F4O4/c8-5(9)7(10,11)3-13-1-4-2-14-6(12)15-4/h4-5H,1-3H2/t4-/m1/s1 |
| InChIKey | QGDPMSPKJHCTMF-SCSAIBSYSA-N |
| XLogP | 1.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|