C9H9F7O4 — CID 138625430
4-(3,3,4,4,5,5,5-heptafluoropentoxymethyl)-1,3-dioxolan-2-one (PubChem CID 138625430) has the molecular formula C9H9F7O4 and a molecular weight of 314.15 g/mol. Its IUPAC name is 4-(3,3,4,4,5,5,5-heptafluoropentoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(3,3,4,4,5,5,5-heptafluoropentoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 138625430 |
| Molecular Formula | C9H9F7O4 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(3,3,4,4,5,5,5-heptafluoropentoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COCCC(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C9H9F7O4/c10-7(11,8(12,13)9(14,15)16)1-2-18-3-5-4-19-6(17)20-5/h5H,1-4H2 |
| InChIKey | QWBOCNLGZWWLGE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|