C12H14F8O4 — CID 176897353
2-[[1,1,2,2,3,3,4,4-octafluoro-6-(oxiran-2-ylmethoxy)hexoxy]methyl]oxirane (PubChem CID 176897353) has the molecular formula C12H14F8O4 and a molecular weight of 374.22 g/mol. Its IUPAC name is 2-[[1,1,2,2,3,3,4,4-octafluoro-6-(oxiran-2-ylmethoxy)hexoxy]methyl]oxirane.
| Compound Name | 2-[[1,1,2,2,3,3,4,4-octafluoro-6-(oxiran-2-ylmethoxy)hexoxy]methyl]oxirane |
|---|---|
| PubChem CID | 176897353 |
| Molecular Formula | C12H14F8O4 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-[[1,1,2,2,3,3,4,4-octafluoro-6-(oxiran-2-ylmethoxy)hexoxy]methyl]oxirane |
| SMILES | FC(F)(CCOCC1CO1)C(F)(F)C(F)(F)C(F)(F)OCC1CO1 |
| InChI | InChI=1S/C12H14F8O4/c13-9(14,1-2-21-3-7-4-22-7)10(15,16)11(17,18)12(19,20)24-6-8-5-23-8/h7-8H,1-6H2 |
| InChIKey | FCULPLXUPVEURR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|