C29H40F12O12 — CID 58122106
2-[[3-[3-[1,1-difluoro-3-(oxiran-2-ylmethoxy)propoxy]-2,2-bis[[2,2-difluoro-3-(oxiran-2-ylmethoxy)propoxy]methyl]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]methyl]oxirane (PubChem CID 58122106) has the molecular formula C29H40F12O12 and a molecular weight of 808.60 g/mol. Its IUPAC name is 2-[[3-[3-[1,1-difluoro-3-(oxiran-2-ylmethoxy)propoxy]-2,2-bis[[2,2-difluoro-3-(oxiran-2-ylmethoxy)propoxy]methyl]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]methyl]oxirane.
| Compound Name | 2-[[3-[3-[1,1-difluoro-3-(oxiran-2-ylmethoxy)propoxy]-2,2-bis[[2,2-difluoro-3-(oxiran-2-ylmethoxy)propoxy]methyl]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]methyl]oxirane |
|---|---|
| PubChem CID | 58122106 |
| Molecular Formula | C29H40F12O12 |
| Molecular Weight | 808.60 g/mol |
| Exact Mass | 808.23 |
| IUPAC Name | 2-[[3-[3-[1,1-difluoro-3-(oxiran-2-ylmethoxy)propoxy]-2,2-bis[[2,2-difluoro-3-(oxiran-2-ylmethoxy)propoxy]methyl]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]methyl]oxirane |
| SMILES | FC(F)(COCC1CO1)COCC(COCC(F)(F)COCC1CO1)(C(F)(F)OC(F)(F)CCOCC1CO1)C(F)(F)OC(F)(F)CCOCC1CO1 |
| InChI | InChI=1S/C29H40F12O12/c30-24(31,15-44-7-21-11-50-21)17-46-13-23(14-47-18-25(32,33)16-45-8-22-12-51-22,28(38,39)52-26(34,35)1-3-42-5-19-9-48-19)29(40,41)53-27(36,37)2-4-43-6-20-10-49-20/h19-22H,1-18H2 |
| InChIKey | OSCRXWRVHKJELQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 123.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|