C14H26O7Si — CID 173303950
[1,4-bis(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)butan-2-yl]oxysilane (PubChem CID 173303950) has the molecular formula C14H26O7Si and a molecular weight of 334.44 g/mol. Its IUPAC name is [1,4-bis(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)butan-2-yl]oxysilane.
| Compound Name | [1,4-bis(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)butan-2-yl]oxysilane |
|---|---|
| PubChem CID | 173303950 |
| Molecular Formula | C14H26O7Si |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [1,4-bis(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)butan-2-yl]oxysilane |
| SMILES | [SiH3]OC(CCOCC1CO1)(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C14H26O7Si/c22-21-14(9-16-4-12-7-19-12,10-17-5-13-8-20-13)1-2-15-3-11-6-18-11/h11-13H,1-10H2,22H3 |
| InChIKey | AMLJRKKMEIRFTB-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 74.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|