About 2-(oxiran-2-ylmethoxymethyl)oxirane diazide
2-(oxiran-2-ylmethoxymethyl)oxirane diazide (PubChem CID 175700488) has the molecular formula C6H10N6O3-2
and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane diazide.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane diazide |
| PubChem CID | 175700488 |
| Molecular Formula | C6H10N6O3-2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane diazide |
| SMILES | C(OCC1CO1)C1CO1.[N-]=[N+]=[N-].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C6H10O3.2N3/c1(5-3-8-5)7-2-6-4-9-6;2*1-3-2/h5-6H,1-4H2;;/q;2*-1 |
| InChIKey | NUOMERKBGINCKL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 151.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane diazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane diazide?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane diazide (CID 175700488) is 2-(oxiran-2-ylmethoxymethyl)oxirane diazide.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane diazide?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane diazide is C(OCC1CO1)C1CO1.[N-]=[N+]=[N-].[N-]=[N+]=[N-].
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane diazide?
The InChIKey is NUOMERKBGINCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.2N3/c1(5-3-8-5)7-2-6-4-9-6;2*1-3-2/h5-6H,1-4H2;;/q;2*-1.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane diazide?
2-(oxiran-2-ylmethoxymethyl)oxirane diazide has a molecular weight of 214.18 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane diazide is sourced from PubChem (CID 175700488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).