About 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane
2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane (PubChem CID 22290133) has the molecular formula C6H11O4P
and a molecular weight of 178.12 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane |
| PubChem CID | 22290133 |
| Molecular Formula | C6H11O4P |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane |
| SMILES | C(OCC1CO1)C1CO1.O=P |
| InChI | InChI=1S/C6H10O3.HOP/c1(5-3-8-5)7-2-6-4-9-6;1-2/h5-6H,1-4H2;2H |
| InChIKey | FRGVCAFUBFDDHD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.12 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane (CID 22290133) is 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane is C(OCC1CO1)C1CO1.O=P.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane?
The InChIKey is FRGVCAFUBFDDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.HOP/c1(5-3-8-5)7-2-6-4-9-6;1-2/h5-6H,1-4H2;2H.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane?
2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane has a molecular weight of 178.12 g/mol, XLogP of 0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;oxophosphane is sourced from PubChem (CID 22290133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).