About hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane
hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 166784173) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 166784173 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.O=CCCCCC=O |
| InChI | InChI=1S/C6H10O3.C6H10O2/c1(5-3-8-5)7-2-6-4-9-6;7-5-3-1-2-4-6-8/h5-6H,1-4H2;5-6H,1-4H2 |
| InChIKey | BBSVTVSZDCLBGX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 166784173) is hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.O=CCCCCC=O.
What is the InChIKey of hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is BBSVTVSZDCLBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H10O2/c1(5-3-8-5)7-2-6-4-9-6;7-5-3-1-2-4-6-8/h5-6H,1-4H2;5-6H,1-4H2.
What are the key properties of hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane?
hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 244.29 g/mol, XLogP of 0.75, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexanedial;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 166784173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).