About 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene
2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene (PubChem CID 88761424) has the molecular formula C8H12O3S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene |
| PubChem CID | 88761424 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene |
| SMILES | C(OCC1CO1)C1CO1.C1=CS1 |
| InChI | InChI=1S/C6H10O3.C2H2S/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-1/h5-6H,1-4H2;1-2H |
| InChIKey | BKZQCRUTWFOFAF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene (CID 88761424) is 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene is C(OCC1CO1)C1CO1.C1=CS1.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene?
The InChIKey is BKZQCRUTWFOFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C2H2S/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-1/h5-6H,1-4H2;1-2H.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene?
2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene has a molecular weight of 188.25 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;thiirene is sourced from PubChem (CID 88761424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).