C12H14Br2O3 — CID 87260520
1,2-dibromobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 87260520) has the molecular formula C12H14Br2O3 and a molecular weight of 366.05 g/mol. Its IUPAC name is 1,2-dibromobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 1,2-dibromobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 87260520 |
| Molecular Formula | C12H14Br2O3 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 1,2-dibromobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | Brc1ccccc1Br.C(OCC1CO1)C1CO1 |
| InChI | InChI=1S/C6H4Br2.C6H10O3/c7-5-3-1-2-4-6(5)8;1(5-3-8-5)7-2-6-4-9-6/h1-4H;5-6H,1-4H2 |
| InChIKey | KXFAKLQTBGMAHO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|