About oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol
oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol (PubChem CID 87608532) has the molecular formula C14H20O5
and a molecular weight of 268.31 g/mol. Its IUPAC name is oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol.
Molecular Properties
| Compound Name | oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol |
| PubChem CID | 87608532 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol |
| SMILES | C(OCC1CO1)C1CO1.C1CO1.Oc1ccccc1 |
| InChI | InChI=1S/C6H10O3.C6H6O.C2H4O/c1(5-3-8-5)7-2-6-4-9-6;7-6-4-2-1-3-5-6;1-2-3-1/h5-6H,1-4H2;1-5,7H;1-2H2 |
| InChIKey | PWUFMGCHUIWISQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol?
The IUPAC name of oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol (CID 87608532) is oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol.
What is the SMILES notation for oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol?
The canonical SMILES for oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol is C(OCC1CO1)C1CO1.C1CO1.Oc1ccccc1.
What is the InChIKey of oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol?
The InChIKey is PWUFMGCHUIWISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H6O.C2H4O/c1(5-3-8-5)7-2-6-4-9-6;7-6-4-2-1-3-5-6;1-2-3-1/h5-6H,1-4H2;1-5,7H;1-2H2.
What are the key properties of oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol?
oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol has a molecular weight of 268.31 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;2-(oxiran-2-ylmethoxymethyl)oxirane;phenol is sourced from PubChem (CID 87608532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).