About (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane
(3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174645892) has the molecular formula C12H15ClO5
and a molecular weight of 274.70 g/mol. Its IUPAC name is (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 174645892 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Oc1cccc(OCl)c1 |
| InChI | InChI=1S/C6H5ClO2.C6H10O3/c7-9-6-3-1-2-5(8)4-6;1(5-3-8-5)7-2-6-4-9-6/h1-4,8H;5-6H,1-4H2 |
| InChIKey | PBIKEKFETYDXCI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 174645892) is (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.Oc1cccc(OCl)c1.
What is the InChIKey of (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is PBIKEKFETYDXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO2.C6H10O3/c7-9-6-3-1-2-5(8)4-6;1(5-3-8-5)7-2-6-4-9-6/h1-4,8H;5-6H,1-4H2.
What are the key properties of (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane?
(3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 274.70 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) hypochlorite;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 174645892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).