C16H24O5 — CID 174368785
3-(2-methylpropoxy)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174368785) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-(2-methylpropoxy)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 3-(2-methylpropoxy)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174368785 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-(2-methylpropoxy)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC(C)COc1cccc(O)c1 |
| InChI | InChI=1S/C10H14O2.C6H10O3/c1-8(2)7-12-10-5-3-4-9(11)6-10;1(5-3-8-5)7-2-6-4-9-6/h3-6,8,11H,7H2,1-2H3;5-6H,1-4H2 |
| InChIKey | TVBITLXGDRSXGK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|