C18H22O7 — CID 158653156
bis(benzene-1,4-diol);2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 158653156) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is bis(benzene-1,4-diol);2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | bis(benzene-1,4-diol);2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 158653156 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | bis(benzene-1,4-diol);2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Oc1ccc(O)cc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H10O3.2C6H6O2/c1(5-3-8-5)7-2-6-4-9-6;2*7-5-1-2-6(8)4-3-5/h5-6H,1-4H2;2*1-4,7-8H |
| InChIKey | IBULZCSSGLIOPT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|