C25H32O5 — CID 175043202
4-[1-(4-hydroxyphenyl)-2-methylcyclohexyl]phenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 175043202) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-2-methylcyclohexyl]phenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 4-[1-(4-hydroxyphenyl)-2-methylcyclohexyl]phenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 175043202 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-2-methylcyclohexyl]phenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC1CCCCC1(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H22O2.C6H10O3/c1-14-4-2-3-13-19(14,15-5-9-17(20)10-6-15)16-7-11-18(21)12-8-16;1(5-3-8-5)7-2-6-4-9-6/h5-12,14,20-21H,2-4,13H2,1H3;5-6H,1-4H2 |
| InChIKey | PNMYNCDCIUJUCH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|