C22H28O5 — CID 146291909
4-(4-hydroxy-2,3-dimethylphenyl)-2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 146291909) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-(4-hydroxy-2,3-dimethylphenyl)-2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 4-(4-hydroxy-2,3-dimethylphenyl)-2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 146291909 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 4-(4-hydroxy-2,3-dimethylphenyl)-2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Cc1c(O)ccc(-c2ccc(O)c(C)c2C)c1C |
| InChI | InChI=1S/C16H18O2.C6H10O3/c1-9-11(3)15(17)7-5-13(9)14-6-8-16(18)12(4)10(14)2;1(5-3-8-5)7-2-6-4-9-6/h5-8,17-18H,1-4H3;5-6H,1-4H2 |
| InChIKey | DKVSBMDUGLJTSV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|