C18H25NO6 — CID 174652653
4-amino-2,3-bis(oxiran-2-ylmethyl)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174652653) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 4-amino-2,3-bis(oxiran-2-ylmethyl)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 4-amino-2,3-bis(oxiran-2-ylmethyl)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174652653 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-amino-2,3-bis(oxiran-2-ylmethyl)phenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Nc1ccc(O)c(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C12H15NO3.C6H10O3/c13-11-1-2-12(14)10(4-8-6-16-8)9(11)3-7-5-15-7;1(5-3-8-5)7-2-6-4-9-6/h1-2,7-8,14H,3-6,13H2;5-6H,1-4H2 |
| InChIKey | XEPWTXZZUHNJIE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|