C30H38N2O8 — CID 118073263
5-amino-2,3,4-tris(oxiran-2-ylmethyl)phenol;3-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline (PubChem CID 118073263) has the molecular formula C30H38N2O8 and a molecular weight of 554.64 g/mol. Its IUPAC name is 5-amino-2,3,4-tris(oxiran-2-ylmethyl)phenol;3-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 5-amino-2,3,4-tris(oxiran-2-ylmethyl)phenol;3-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 118073263 |
| Molecular Formula | C30H38N2O8 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 5-amino-2,3,4-tris(oxiran-2-ylmethyl)phenol;3-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
| SMILES | Nc1cc(O)c(CC2CO2)c(CC2CO2)c1CC1CO1.c1cc(OCC2CO2)cc(N(CC2CO2)CC2CO2)c1 |
| InChI | InChI=1S/2C15H19NO4/c16-14-4-15(17)13(3-10-7-20-10)11(1-8-5-18-8)12(14)2-9-6-19-9;1-2-11(4-12(3-1)17-9-15-10-20-15)16(5-13-7-18-13)6-14-8-19-14/h4,8-10,17H,1-3,5-7,16H2;1-4,13-15H,5-10H2 |
| InChIKey | TYGHCVPNTNTGNJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|