C39H42N2O6 — CID 141224972
3-[4-[2-[4-[3-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline (PubChem CID 141224972) has the molecular formula C39H42N2O6 and a molecular weight of 634.77 g/mol. Its IUPAC name is 3-[4-[2-[4-[3-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 3-[4-[2-[4-[3-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 141224972 |
| Molecular Formula | C39H42N2O6 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | 3-[4-[2-[4-[3-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]propan-2-yl]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline |
| SMILES | CC(C)(c1ccc(Oc2cccc(N(CC3CO3)CC3CO3)c2)cc1)c1ccc(Oc2cccc(N(CC3CO3)CC3CO3)c2)cc1 |
| InChI | InChI=1S/C39H42N2O6/c1-39(2,27-9-13-31(14-10-27)46-33-7-3-5-29(17-33)40(19-35-23-42-35)20-36-24-43-36)28-11-15-32(16-12-28)47-34-8-4-6-30(18-34)41(21-37-25-44-37)22-38-26-45-38/h3-18,35-38H,19-26H2,1-2H3 |
| InChIKey | VIAGNODXEJOHRL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|