C24H28N2O5 — CID 53389713
3-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline (PubChem CID 53389713) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 3-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 53389713 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]-N,N-bis(oxiran-2-ylmethyl)aniline |
| SMILES | c1cc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc(N(CC2CO2)CC2CO2)c1 |
| InChI | InChI=1S/C24H28N2O5/c1-2-18(26(11-23-15-29-23)12-24-16-30-24)8-20(3-1)31-19-6-4-17(5-7-19)25(9-21-13-27-21)10-22-14-28-22/h1-8,21-24H,9-16H2 |
| InChIKey | JHFDZMAMPQNAMX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|