About 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane
9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174796639) has the molecular formula C26H28O4
and a molecular weight of 404.51 g/mol. Its IUPAC name is 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 174796639 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Cc1ccccc1O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C7H8O.C6H10O3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-6-4-2-3-5-7(6)8;1(5-3-8-5)7-2-6-4-9-6/h1-8H,9H2;2-5,8H,1H3;5-6H,1-4H2 |
| InChIKey | BRVFHBVQPLZBDB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 174796639) is 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.Cc1ccccc1O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is BRVFHBVQPLZBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C7H8O.C6H10O3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-6-4-2-3-5-7(6)8;1(5-3-8-5)7-2-6-4-9-6/h1-8H,9H2;2-5,8H,1H3;5-6H,1-4H2.
What are the key properties of 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane?
9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 404.51 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;2-methylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 174796639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).