C34H52O5 — CID 174988323
2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,4,5-tetratert-butyl-6-(2-hydroxyphenyl)phenol (PubChem CID 174988323) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,4,5-tetratert-butyl-6-(2-hydroxyphenyl)phenol.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,4,5-tetratert-butyl-6-(2-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 174988323 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,4,5-tetratert-butyl-6-(2-hydroxyphenyl)phenol |
| SMILES | C(OCC1CO1)C1CO1.CC(C)(C)c1c(O)c(-c2ccccc2O)c(C(C)(C)C)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C28H42O2.C6H10O3/c1-25(2,3)20-19(17-15-13-14-16-18(17)29)24(30)23(28(10,11)12)22(27(7,8)9)21(20)26(4,5)6;1(5-3-8-5)7-2-6-4-9-6/h13-16,29-30H,1-12H3;5-6H,1-4H2 |
| InChIKey | DJYWCSOCOMXOIM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|