About 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol
2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol (PubChem CID 155195839) has the molecular formula C32H32O7
and a molecular weight of 528.60 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol |
| PubChem CID | 155195839 |
| Molecular Formula | C32H32O7 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol |
| SMILES | C(OCC1CO1)C1CO1.Oc1ccccc1CC(c1ccccc1O)(c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C26H22O4.C6H10O3/c27-22-13-5-1-9-18(22)17-26(19-10-2-6-14-23(19)28,20-11-3-7-15-24(20)29)21-12-4-8-16-25(21)30;1(5-3-8-5)7-2-6-4-9-6/h1-16,27-30H,17H2;5-6H,1-4H2 |
| InChIKey | MMKNKSKMRYVDNN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol (CID 155195839) is 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol is C(OCC1CO1)C1CO1.Oc1ccccc1CC(c1ccccc1O)(c1ccccc1O)c1ccccc1O.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol?
The InChIKey is MMKNKSKMRYVDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O4.C6H10O3/c27-22-13-5-1-9-18(22)17-26(19-10-2-6-14-23(19)28,20-11-3-7-15-24(20)29)21-12-4-8-16-25(21)30;1(5-3-8-5)7-2-6-4-9-6/h1-16,27-30H,17H2;5-6H,1-4H2.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol?
2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol has a molecular weight of 528.60 g/mol, XLogP of 4.89, 9 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;2-[2,2,2-tris(2-hydroxyphenyl)ethyl]phenol is sourced from PubChem (CID 155195839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).