About 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol
2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol (PubChem CID 86652086) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol |
| PubChem CID | 86652086 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol |
| SMILES | C(OCC1CO1)C1CO1.Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H10O.C6H10O3/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;1(5-3-8-5)7-2-6-4-9-6/h1-9,13H;5-6H,1-4H2 |
| InChIKey | UHLYCUNVFDGYNL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol (CID 86652086) is 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol is C(OCC1CO1)C1CO1.Oc1cccc(-c2ccccc2)c1.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol?
The InChIKey is UHLYCUNVFDGYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C6H10O3/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;1(5-3-8-5)7-2-6-4-9-6/h1-9,13H;5-6H,1-4H2.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol?
2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol has a molecular weight of 300.35 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;3-phenylphenol is sourced from PubChem (CID 86652086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).