About 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol
2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol (PubChem CID 88787409) has the molecular formula C27H46O4
and a molecular weight of 434.66 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol |
| PubChem CID | 88787409 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol |
| SMILES | C(OCC1CO1)C1CO1.CCCCCCCCCCCCCCCc1cccc(O)c1 |
| InChI | InChI=1S/C21H36O.C6H10O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20;1(5-3-8-5)7-2-6-4-9-6/h15,17-19,22H,2-14,16H2,1H3;5-6H,1-4H2 |
| InChIKey | MWQAAZMFIRNKGQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol (CID 88787409) is 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol is C(OCC1CO1)C1CO1.CCCCCCCCCCCCCCCc1cccc(O)c1.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol?
The InChIKey is MWQAAZMFIRNKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O.C6H10O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20;1(5-3-8-5)7-2-6-4-9-6/h15,17-19,22H,2-14,16H2,1H3;5-6H,1-4H2.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol?
2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol has a molecular weight of 434.66 g/mol, XLogP of 6.83, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;3-pentadecylphenol is sourced from PubChem (CID 88787409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).