About 2-methyl-5-nonylphenol;3-nonylphenol
2-methyl-5-nonylphenol;3-nonylphenol (PubChem CID 19003711) has the molecular formula C31H50O2
and a molecular weight of 454.74 g/mol. Its IUPAC name is 2-methyl-5-nonylphenol;3-nonylphenol.
Molecular Properties
| Compound Name | 2-methyl-5-nonylphenol;3-nonylphenol |
| PubChem CID | 19003711 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 2-methyl-5-nonylphenol;3-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(C)c(O)c1.CCCCCCCCCc1cccc(O)c1 |
| InChI | InChI=1S/C16H26O.C15H24O/c1-3-4-5-6-7-8-9-10-15-12-11-14(2)16(17)13-15;1-2-3-4-5-6-7-8-10-14-11-9-12-15(16)13-14/h11-13,17H,3-10H2,1-2H3;9,11-13,16H,2-8,10H2,1H3 |
| InChIKey | QVECQBUKEFUYIT-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nonylphenol;3-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nonylphenol;3-nonylphenol?
The IUPAC name of 2-methyl-5-nonylphenol;3-nonylphenol (CID 19003711) is 2-methyl-5-nonylphenol;3-nonylphenol.
What is the SMILES notation for 2-methyl-5-nonylphenol;3-nonylphenol?
The canonical SMILES for 2-methyl-5-nonylphenol;3-nonylphenol is CCCCCCCCCc1ccc(C)c(O)c1.CCCCCCCCCc1cccc(O)c1.
What is the InChIKey of 2-methyl-5-nonylphenol;3-nonylphenol?
The InChIKey is QVECQBUKEFUYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O.C15H24O/c1-3-4-5-6-7-8-9-10-15-12-11-14(2)16(17)13-15;1-2-3-4-5-6-7-8-10-14-11-9-12-15(16)13-14/h11-13,17H,3-10H2,1-2H3;9,11-13,16H,2-8,10H2,1H3.
What are the key properties of 2-methyl-5-nonylphenol;3-nonylphenol?
2-methyl-5-nonylphenol;3-nonylphenol has a molecular weight of 454.74 g/mol, XLogP of 9.68, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nonylphenol;3-nonylphenol is sourced from PubChem (CID 19003711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).