C22H32O5 — CID 175107460
2-(2-hydroxyphenyl)-3,3,5,5-tetramethylcyclohexen-1-ol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 175107460) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-3,3,5,5-tetramethylcyclohexen-1-ol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 2-(2-hydroxyphenyl)-3,3,5,5-tetramethylcyclohexen-1-ol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 175107460 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-(2-hydroxyphenyl)-3,3,5,5-tetramethylcyclohexen-1-ol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC1(C)CC(O)=C(c2ccccc2O)C(C)(C)C1 |
| InChI | InChI=1S/C16H22O2.C6H10O3/c1-15(2)9-13(18)14(16(3,4)10-15)11-7-5-6-8-12(11)17;1(5-3-8-5)7-2-6-4-9-6/h5-8,17-18H,9-10H2,1-4H3;5-6H,1-4H2 |
| InChIKey | YJWYXJQQVQZVRD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|