9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid

C20H20O3 — CID 175383230

IUPAC9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid
SMILESCC(=CCC1CO1)C(=O)O.c1ccc2c(c1)Cc1ccccc1-2
InChIInChI=1S/C13H10.C7H10O3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-5(7(8)9)2-3-6-4-10-6/h1-8H,9H2;2,6H,3-4H2,1H3,(H,8,9)
InChIKeyUEWHFIRDVTVBJO-UHFFFAOYSA-N
MW308.38 g/mol
LogP4.06
Rot. Bonds3

About 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid

9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid (PubChem CID 175383230) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid.

Molecular Properties

Compound Name9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid
PubChem CID175383230
Molecular FormulaC20H20O3
Molecular Weight308.38 g/mol
Exact Mass308.14
IUPAC Name9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid
SMILESCC(=CCC1CO1)C(=O)O.c1ccc2c(c1)Cc1ccccc1-2
InChIInChI=1S/C13H10.C7H10O3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-5(7(8)9)2-3-6-4-10-6/h1-8H,9H2;2,6H,3-4H2,1H3,(H,8,9)
InChIKeyUEWHFIRDVTVBJO-UHFFFAOYSA-N
XLogP4.06
TPSA49.83 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.38
LogP ≤ 54.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
The IUPAC name of 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid (CID 175383230) is 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid.
What is the SMILES notation for 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
The canonical SMILES for 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid is CC(=CCC1CO1)C(=O)O.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
The InChIKey is UEWHFIRDVTVBJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C7H10O3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-5(7(8)9)2-3-6-4-10-6/h1-8H,9H2;2,6H,3-4H2,1H3,(H,8,9).
What are the key properties of 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid has a molecular weight of 308.38 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;2-methyl-4-(oxiran-2-yl)but-2-enoic acid is sourced from PubChem (CID 175383230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).