C19H17F3O2 — CID 175136436
9H-fluorene;5,5,5-trifluoro-2-methylpent-2-enoic acid (PubChem CID 175136436) has the molecular formula C19H17F3O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 9H-fluorene;5,5,5-trifluoro-2-methylpent-2-enoic acid.
| Compound Name | 9H-fluorene;5,5,5-trifluoro-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 175136436 |
| Molecular Formula | C19H17F3O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 9H-fluorene;5,5,5-trifluoro-2-methylpent-2-enoic acid |
| SMILES | CC(=CCC(F)(F)F)C(=O)O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C6H7F3O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-4(5(10)11)2-3-6(7,8)9/h1-8H,9H2;2H,3H2,1H3,(H,10,11) |
| InChIKey | YAROQMGDBHSKMB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|