C15H13F3O3S — CID 160817133
9H-fluorene;2,2,2-trifluoroethanesulfonic acid (PubChem CID 160817133) has the molecular formula C15H13F3O3S and a molecular weight of 330.33 g/mol. Its IUPAC name is 9H-fluorene;2,2,2-trifluoroethanesulfonic acid.
| Compound Name | 9H-fluorene;2,2,2-trifluoroethanesulfonic acid |
|---|---|
| PubChem CID | 160817133 |
| Molecular Formula | C15H13F3O3S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 9H-fluorene;2,2,2-trifluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)CC(F)(F)F.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C2H3F3O3S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;3-2(4,5)1-9(6,7)8/h1-8H,9H2;1H2,(H,6,7,8) |
| InChIKey | SFAWYUANHQXMEO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|