C9H16O4 — CID 175380633
ethanol;2-methyl-4-(oxiran-2-yl)but-2-enoic acid (PubChem CID 175380633) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is ethanol;2-methyl-4-(oxiran-2-yl)but-2-enoic acid.
| Compound Name | ethanol;2-methyl-4-(oxiran-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 175380633 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | ethanol;2-methyl-4-(oxiran-2-yl)but-2-enoic acid |
| SMILES | CC(=CCC1CO1)C(=O)O.CCO |
| InChI | InChI=1S/C7H10O3.C2H6O/c1-5(7(8)9)2-3-6-4-10-6;1-2-3/h2,6H,3-4H2,1H3,(H,8,9);3H,2H2,1H3 |
| InChIKey | BTONWSZAYZRSRM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|