C11H16O5 — CID 173148630
2-methylbut-2-enoic acid;2-(oxiran-2-ylmethyl)prop-2-enoic acid (PubChem CID 173148630) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid;2-(oxiran-2-ylmethyl)prop-2-enoic acid.
| Compound Name | 2-methylbut-2-enoic acid;2-(oxiran-2-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 173148630 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-methylbut-2-enoic acid;2-(oxiran-2-ylmethyl)prop-2-enoic acid |
| SMILES | C=C(CC1CO1)C(=O)O.CC=C(C)C(=O)O |
| InChI | InChI=1S/C6H8O3.C5H8O2/c1-4(6(7)8)2-5-3-9-5;1-3-4(2)5(6)7/h5H,1-3H2,(H,7,8);3H,1-2H3,(H,6,7) |
| InChIKey | AEOJICNTIQUYGB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|