C15H26O7 — CID 88716952
2-methylbut-2-enoic acid;2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane (PubChem CID 88716952) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid;2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane.
| Compound Name | 2-methylbut-2-enoic acid;2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 88716952 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-methylbut-2-enoic acid;2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane |
| SMILES | C(COCC1CO1)OCCOCC1CO1.CC=C(C)C(=O)O |
| InChI | InChI=1S/C10H18O5.C5H8O2/c1(3-12-5-9-7-14-9)11-2-4-13-6-10-8-15-10;1-3-4(2)5(6)7/h9-10H,1-8H2;3H,1-2H3,(H,6,7) |
| InChIKey | DWFOPLKSWBCXKI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|