C11H18O4 — CID 19885320
8-(oxiran-2-ylmethoxy)octane-2,5-dione (PubChem CID 19885320) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 8-(oxiran-2-ylmethoxy)octane-2,5-dione.
| Compound Name | 8-(oxiran-2-ylmethoxy)octane-2,5-dione |
|---|---|
| PubChem CID | 19885320 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 8-(oxiran-2-ylmethoxy)octane-2,5-dione |
| SMILES | CC(=O)CCC(=O)CCCOCC1CO1 |
| InChI | InChI=1S/C11H18O4/c1-9(12)4-5-10(13)3-2-6-14-7-11-8-15-11/h11H,2-8H2,1H3 |
| InChIKey | NSZWETHTNJIICP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|